C21H22BrN5O — CID 18789581
6-[[2-(benzylamino)-5-bromophenyl]methyl-ethylamino]pyridazine-3-carboxamide (PubChem CID 18789581) has the molecular formula C21H22BrN5O and a molecular weight of 440.35 g/mol. Its IUPAC name is 6-[[2-(benzylamino)-5-bromophenyl]methyl-ethylamino]pyridazine-3-carboxamide.
| Compound Name | 6-[[2-(benzylamino)-5-bromophenyl]methyl-ethylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 18789581 |
| Molecular Formula | C21H22BrN5O |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 6-[[2-(benzylamino)-5-bromophenyl]methyl-ethylamino]pyridazine-3-carboxamide |
| SMILES | CCN(Cc1cc(Br)ccc1NCc1ccccc1)c1ccc(C(N)=O)nn1 |
| InChI | InChI=1S/C21H22BrN5O/c1-2-27(20-11-10-19(21(23)28)25-26-20)14-16-12-17(22)8-9-18(16)24-13-15-6-4-3-5-7-15/h3-12,24H,2,13-14H2,1H3,(H2,23,28) |
| InChIKey | MEZUCLIMXWDRRA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |