C17H20BrN3O3 — CID 22622530
6-[(5-bromo-2-propoxyphenyl)methyl-ethylamino]pyridazine-3-carboxylic acid (PubChem CID 22622530) has the molecular formula C17H20BrN3O3 and a molecular weight of 394.27 g/mol. Its IUPAC name is 6-[(5-bromo-2-propoxyphenyl)methyl-ethylamino]pyridazine-3-carboxylic acid.
| Compound Name | 6-[(5-bromo-2-propoxyphenyl)methyl-ethylamino]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 22622530 |
| Molecular Formula | C17H20BrN3O3 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 6-[(5-bromo-2-propoxyphenyl)methyl-ethylamino]pyridazine-3-carboxylic acid |
| SMILES | CCCOc1ccc(Br)cc1CN(CC)c1ccc(C(=O)O)nn1 |
| InChI | InChI=1S/C17H20BrN3O3/c1-3-9-24-15-7-5-13(18)10-12(15)11-21(4-2)16-8-6-14(17(22)23)19-20-16/h5-8,10H,3-4,9,11H2,1-2H3,(H,22,23) |
| InChIKey | SIGLSFHKYOINAE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |