C13H21N3O4 — CID 82956314
6-[bis(2-ethoxyethyl)amino]pyridazine-3-carboxylic acid (PubChem CID 82956314) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 6-[bis(2-ethoxyethyl)amino]pyridazine-3-carboxylic acid.
| Compound Name | 6-[bis(2-ethoxyethyl)amino]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 82956314 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 6-[bis(2-ethoxyethyl)amino]pyridazine-3-carboxylic acid |
| SMILES | CCOCCN(CCOCC)c1ccc(C(=O)O)nn1 |
| InChI | InChI=1S/C13H21N3O4/c1-3-19-9-7-16(8-10-20-4-2)12-6-5-11(13(17)18)14-15-12/h5-6H,3-4,7-10H2,1-2H3,(H,17,18) |
| InChIKey | IVRZCSFKGDSGHB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|