C12H18N4O3 — CID 54990351
6-[[2-(dimethylamino)-2-oxoethyl]-propylamino]pyridazine-3-carboxylic acid (PubChem CID 54990351) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-[[2-(dimethylamino)-2-oxoethyl]-propylamino]pyridazine-3-carboxylic acid.
| Compound Name | 6-[[2-(dimethylamino)-2-oxoethyl]-propylamino]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 54990351 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 6-[[2-(dimethylamino)-2-oxoethyl]-propylamino]pyridazine-3-carboxylic acid |
| SMILES | CCCN(CC(=O)N(C)C)c1ccc(C(=O)O)nn1 |
| InChI | InChI=1S/C12H18N4O3/c1-4-7-16(8-11(17)15(2)3)10-6-5-9(12(18)19)13-14-10/h5-6H,4,7-8H2,1-3H3,(H,18,19) |
| InChIKey | XFJXNFGEVUXVFZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |