C21H30 — CID 18798401
2-(2,4-dibutylcyclopenta-1,4-dien-1-yl)ethylbenzene (PubChem CID 18798401) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 2-(2,4-dibutylcyclopenta-1,4-dien-1-yl)ethylbenzene.
| Compound Name | 2-(2,4-dibutylcyclopenta-1,4-dien-1-yl)ethylbenzene |
|---|---|
| PubChem CID | 18798401 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-(2,4-dibutylcyclopenta-1,4-dien-1-yl)ethylbenzene |
| SMILES | CCCCC1=CC(CCc2ccccc2)=C(CCCC)C1 |
| InChI | InChI=1S/C21H30/c1-3-5-10-19-16-20(13-6-4-2)21(17-19)15-14-18-11-8-7-9-12-18/h7-9,11-12,17H,3-6,10,13-16H2,1-2H3 |
| InChIKey | AWKMNBMYYWKJLQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |