About 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene
2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene (PubChem CID 18798349) has the molecular formula C17H22
and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene.
Analyze 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene?
The IUPAC name of 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene (CID 18798349) is 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene.
What is the SMILES notation for 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene?
The canonical SMILES for 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene is CCC1=CC(CCc2ccccc2)=C(CC)C1.
What is the InChIKey of 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene?
The InChIKey is MTIWZDWJNVUMPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22/c1-3-14-12-16(4-2)17(13-14)11-10-15-8-6-5-7-9-15/h5-9,13H,3-4,10-12H2,1-2H3.
What are the key properties of 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene?
2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene has a molecular weight of 226.36 g/mol, XLogP of 5.07, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-diethylcyclopenta-1,4-dien-1-yl)ethylbenzene is sourced from PubChem (CID 18798349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).