C28H30N4O5S2 — CID 18805416
(5E)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18805416) has the molecular formula C28H30N4O5S2 and a molecular weight of 566.71 g/mol. Its IUPAC name is (5E)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18805416 |
| Molecular Formula | C28H30N4O5S2 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | (5E)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CCN2C(=O)/C(=C\c3c(N4CC(C)OC(C)C4)nc4ccccn4c3=O)SC2=S)cc1OC |
| InChI | InChI=1S/C28H30N4O5S2/c1-17-15-30(16-18(2)37-17)25-20(26(33)31-11-6-5-7-24(31)29-25)14-23-27(34)32(28(38)39-23)12-10-19-8-9-21(35-3)22(13-19)36-4/h5-9,11,13-14,17-18H,10,12,15-16H2,1-4H3/b23-14+ |
| InChIKey | YELZPWLIJRHIKH-OEAKJJBVSA-N |
| XLogP | 3.77 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|