C31H31NO6 — CID 18809683
1-(4-butoxy-3-ethoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18809683) has the molecular formula C31H31NO6 and a molecular weight of 513.59 g/mol. Its IUPAC name is 1-(4-butoxy-3-ethoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxy-3-ethoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18809683 |
| Molecular Formula | C31H31NO6 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 1-(4-butoxy-3-ethoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccccc4c3=O)C(=O)N2Cc2ccc(OC)cc2)cc1OCC |
| InChI | InChI=1S/C31H31NO6/c1-4-6-17-37-25-16-13-21(18-26(25)36-5-2)28-27-29(33)23-9-7-8-10-24(23)38-30(27)31(34)32(28)19-20-11-14-22(35-3)15-12-20/h7-16,18,28H,4-6,17,19H2,1-3H3 |
| InChIKey | RBWBHHIPDZQUBC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|