C32H32ClNO6 — CID 18810214
7-chloro-1-(4-hexoxy-3-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18810214) has the molecular formula C32H32ClNO6 and a molecular weight of 562.06 g/mol. Its IUPAC name is 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18810214 |
| Molecular Formula | C32H32ClNO6 |
| Molecular Weight | 562.06 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2Cc2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C32H32ClNO6/c1-4-5-6-7-16-39-26-14-10-21(17-27(26)38-3)29-28-30(35)24-18-22(33)11-15-25(24)40-31(28)32(36)34(29)19-20-8-12-23(37-2)13-9-20/h8-15,17-18,29H,4-7,16,19H2,1-3H3 |
| InChIKey | BTOUIJKLNMLANS-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.06 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|