C29H28ClNO6 — CID 18820221
7-chloro-2-(furan-2-ylmethyl)-1-(4-hexoxy-3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18820221) has the molecular formula C29H28ClNO6 and a molecular weight of 522.00 g/mol. Its IUPAC name is 7-chloro-2-(furan-2-ylmethyl)-1-(4-hexoxy-3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-(furan-2-ylmethyl)-1-(4-hexoxy-3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18820221 |
| Molecular Formula | C29H28ClNO6 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 7-chloro-2-(furan-2-ylmethyl)-1-(4-hexoxy-3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2Cc2ccco2)cc1OC |
| InChI | InChI=1S/C29H28ClNO6/c1-3-4-5-6-13-36-23-11-9-18(15-24(23)34-2)26-25-27(32)21-16-19(30)10-12-22(21)37-28(25)29(33)31(26)17-20-8-7-14-35-20/h7-12,14-16,26H,3-6,13,17H2,1-2H3 |
| InChIKey | GQTWDEPXKKAVLH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 82.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|