C31H37ClN2O6 — CID 4705186
7-chloro-1-(4-hexoxy-3-methoxyphenyl)-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4705186) has the molecular formula C31H37ClN2O6 and a molecular weight of 569.10 g/mol. Its IUPAC name is 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4705186 |
| Molecular Formula | C31H37ClN2O6 |
| Molecular Weight | 569.10 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2CCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C31H37ClN2O6/c1-3-4-5-6-16-39-25-10-8-21(19-26(25)37-2)28-27-29(35)23-20-22(32)9-11-24(23)40-30(27)31(36)34(28)13-7-12-33-14-17-38-18-15-33/h8-11,19-20,28H,3-7,12-18H2,1-2H3 |
| InChIKey | SBLVUGPNLLUZOA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.10 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|