C29H33FN2O6 — CID 4705291
1-(4-butoxy-3-methoxyphenyl)-7-fluoro-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4705291) has the molecular formula C29H33FN2O6 and a molecular weight of 524.59 g/mol. Its IUPAC name is 1-(4-butoxy-3-methoxyphenyl)-7-fluoro-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxy-3-methoxyphenyl)-7-fluoro-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4705291 |
| Molecular Formula | C29H33FN2O6 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 1-(4-butoxy-3-methoxyphenyl)-7-fluoro-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(F)cc4c3=O)C(=O)N2CCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C29H33FN2O6/c1-3-4-14-37-23-8-6-19(17-24(23)35-2)26-25-27(33)21-18-20(30)7-9-22(21)38-28(25)29(34)32(26)11-5-10-31-12-15-36-16-13-31/h6-9,17-18,26H,3-5,10-16H2,1-2H3 |
| InChIKey | OWFJVIULYJJFLA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|