C33H42N2O6 — CID 4705275
1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4705275) has the molecular formula C33H42N2O6 and a molecular weight of 562.71 g/mol. Its IUPAC name is 1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4705275 |
| Molecular Formula | C33H42N2O6 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | 1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-2-(3-morpholin-4-ylpropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2CCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C33H42N2O6/c1-5-6-7-8-16-40-26-11-10-24(21-28(26)38-4)30-29-31(36)25-19-22(2)23(3)20-27(25)41-32(29)33(37)35(30)13-9-12-34-14-17-39-18-15-34/h10-11,19-21,30H,5-9,12-18H2,1-4H3 |
| InChIKey | WIWZYLJTOMCZOL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|