C33H34ClNO5 — CID 18811029
2-[(2-chlorophenyl)methyl]-1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18811029) has the molecular formula C33H34ClNO5 and a molecular weight of 560.09 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18811029 |
| Molecular Formula | C33H34ClNO5 |
| Molecular Weight | 560.09 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2Cc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C33H34ClNO5/c1-5-6-7-10-15-39-26-14-13-22(18-28(26)38-4)30-29-31(36)24-16-20(2)21(3)17-27(24)40-32(29)33(37)35(30)19-23-11-8-9-12-25(23)34/h8-9,11-14,16-18,30H,5-7,10,15,19H2,1-4H3 |
| InChIKey | ADBZMCPJRMUIDZ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.09 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|