C31H29Cl2NO5 — CID 18882598
7-chloro-2-[(2-chlorophenyl)methyl]-1-(3-methoxy-4-pentoxyphenyl)-6-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18882598) has the molecular formula C31H29Cl2NO5 and a molecular weight of 566.48 g/mol. Its IUPAC name is 7-chloro-2-[(2-chlorophenyl)methyl]-1-(3-methoxy-4-pentoxyphenyl)-6-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-[(2-chlorophenyl)methyl]-1-(3-methoxy-4-pentoxyphenyl)-6-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18882598 |
| Molecular Formula | C31H29Cl2NO5 |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 7-chloro-2-[(2-chlorophenyl)methyl]-1-(3-methoxy-4-pentoxyphenyl)-6-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4cc(C)c(Cl)cc4c3=O)C(=O)N2Cc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C31H29Cl2NO5/c1-4-5-8-13-38-24-12-11-19(15-26(24)37-3)28-27-29(35)21-16-23(33)18(2)14-25(21)39-30(27)31(36)34(28)17-20-9-6-7-10-22(20)32/h6-7,9-12,14-16,28H,4-5,8,13,17H2,1-3H3 |
| InChIKey | UYCCSHNSFINYBH-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|