C28H30ClNO5 — CID 18882444
7-chloro-1-(4-hexoxy-3-methoxyphenyl)-6-methyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18882444) has the molecular formula C28H30ClNO5 and a molecular weight of 496.00 g/mol. Its IUPAC name is 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-6-methyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-6-methyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18882444 |
| Molecular Formula | C28H30ClNO5 |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-6-methyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCN1C(=O)c2oc3cc(C)c(Cl)cc3c(=O)c2C1c1ccc(OCCCCCC)c(OC)c1 |
| InChI | InChI=1S/C28H30ClNO5/c1-5-7-8-9-13-34-21-11-10-18(15-23(21)33-4)25-24-26(31)19-16-20(29)17(3)14-22(19)35-27(24)28(32)30(25)12-6-2/h6,10-11,14-16,25H,2,5,7-9,12-13H2,1,3-4H3 |
| InChIKey | NISVUNRTWRVBEQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|