C26H26ClNO4 — CID 18882432
7-chloro-6-methyl-1-(3-pentoxyphenyl)-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18882432) has the molecular formula C26H26ClNO4 and a molecular weight of 451.95 g/mol. Its IUPAC name is 7-chloro-6-methyl-1-(3-pentoxyphenyl)-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-6-methyl-1-(3-pentoxyphenyl)-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18882432 |
| Molecular Formula | C26H26ClNO4 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 7-chloro-6-methyl-1-(3-pentoxyphenyl)-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCN1C(=O)c2oc3cc(C)c(Cl)cc3c(=O)c2C1c1cccc(OCCCCC)c1 |
| InChI | InChI=1S/C26H26ClNO4/c1-4-6-7-12-31-18-10-8-9-17(14-18)23-22-24(29)19-15-20(27)16(3)13-21(19)32-25(22)26(30)28(23)11-5-2/h5,8-10,13-15,23H,2,4,6-7,11-12H2,1,3H3 |
| InChIKey | YIZKVWNFBHDKBO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|