C26H27ClN2O4 — CID 19134441
7-chloro-2-[3-(dimethylamino)propyl]-6-methyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19134441) has the molecular formula C26H27ClN2O4 and a molecular weight of 466.97 g/mol. Its IUPAC name is 7-chloro-2-[3-(dimethylamino)propyl]-6-methyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-[3-(dimethylamino)propyl]-6-methyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19134441 |
| Molecular Formula | C26H27ClN2O4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 7-chloro-2-[3-(dimethylamino)propyl]-6-methyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1cccc(C2c3c(oc4cc(C)c(Cl)cc4c3=O)C(=O)N2CCCN(C)C)c1 |
| InChI | InChI=1S/C26H27ClN2O4/c1-5-12-32-18-9-6-8-17(14-18)23-22-24(30)19-15-20(27)16(2)13-21(19)33-25(22)26(31)29(23)11-7-10-28(3)4/h5-6,8-9,13-15,23H,1,7,10-12H2,2-4H3 |
| InChIKey | GBCFGDVTVZVCGQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|