C28H32ClNO4 — CID 18882384
7-chloro-6-methyl-1-[3-(3-methylbutoxy)phenyl]-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18882384) has the molecular formula C28H32ClNO4 and a molecular weight of 482.02 g/mol. Its IUPAC name is 7-chloro-6-methyl-1-[3-(3-methylbutoxy)phenyl]-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-6-methyl-1-[3-(3-methylbutoxy)phenyl]-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18882384 |
| Molecular Formula | C28H32ClNO4 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 7-chloro-6-methyl-1-[3-(3-methylbutoxy)phenyl]-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCN1C(=O)c2oc3cc(C)c(Cl)cc3c(=O)c2C1c1cccc(OCCC(C)C)c1 |
| InChI | InChI=1S/C28H32ClNO4/c1-5-6-7-12-30-25(19-9-8-10-20(15-19)33-13-11-17(2)3)24-26(31)21-16-22(29)18(4)14-23(21)34-27(24)28(30)32/h8-10,14-17,25H,5-7,11-13H2,1-4H3 |
| InChIKey | QTQYEMRUUQJOTD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|