C31H30ClNO4 — CID 18882576
7-chloro-6-methyl-2-[(4-methylphenyl)methyl]-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18882576) has the molecular formula C31H30ClNO4 and a molecular weight of 516.04 g/mol. Its IUPAC name is 7-chloro-6-methyl-2-[(4-methylphenyl)methyl]-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-6-methyl-2-[(4-methylphenyl)methyl]-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18882576 |
| Molecular Formula | C31H30ClNO4 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 7-chloro-6-methyl-2-[(4-methylphenyl)methyl]-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1cccc(C2c3c(oc4cc(C)c(Cl)cc4c3=O)C(=O)N2Cc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C31H30ClNO4/c1-4-5-6-14-36-23-9-7-8-22(16-23)28-27-29(34)24-17-25(32)20(3)15-26(24)37-30(27)31(35)33(28)18-21-12-10-19(2)11-13-21/h7-13,15-17,28H,4-6,14,18H2,1-3H3 |
| InChIKey | AFHCAZIAZVFZHX-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|