C33H34ClNO6 — CID 18882794
7-chloro-2-[2-(3,4-dimethoxyphenyl)ethyl]-6-methyl-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18882794) has the molecular formula C33H34ClNO6 and a molecular weight of 576.09 g/mol. Its IUPAC name is 7-chloro-2-[2-(3,4-dimethoxyphenyl)ethyl]-6-methyl-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-[2-(3,4-dimethoxyphenyl)ethyl]-6-methyl-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18882794 |
| Molecular Formula | C33H34ClNO6 |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 7-chloro-2-[2-(3,4-dimethoxyphenyl)ethyl]-6-methyl-1-(3-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1cccc(C2c3c(oc4cc(C)c(Cl)cc4c3=O)C(=O)N2CCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C33H34ClNO6/c1-5-6-7-15-40-23-10-8-9-22(18-23)30-29-31(36)24-19-25(34)20(2)16-27(24)41-32(29)33(37)35(30)14-13-21-11-12-26(38-3)28(17-21)39-4/h8-12,16-19,30H,5-7,13-15H2,1-4H3 |
| InChIKey | CXUBZPHWMGFHJP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|