C31H30FNO6 — CID 18820709
1-(3-butoxyphenyl)-2-[2-(3,4-dimethoxyphenyl)ethyl]-7-fluoro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18820709) has the molecular formula C31H30FNO6 and a molecular weight of 531.58 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-2-[2-(3,4-dimethoxyphenyl)ethyl]-7-fluoro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-butoxyphenyl)-2-[2-(3,4-dimethoxyphenyl)ethyl]-7-fluoro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18820709 |
| Molecular Formula | C31H30FNO6 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 1-(3-butoxyphenyl)-2-[2-(3,4-dimethoxyphenyl)ethyl]-7-fluoro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc(C2c3c(oc4ccc(F)cc4c3=O)C(=O)N2CCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C31H30FNO6/c1-4-5-15-38-22-8-6-7-20(17-22)28-27-29(34)23-18-21(32)10-12-24(23)39-30(27)31(35)33(28)14-13-19-9-11-25(36-2)26(16-19)37-3/h6-12,16-18,28H,4-5,13-15H2,1-3H3 |
| InChIKey | AVENJANATPJPJZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|