C32H33NO4 — CID 4706800
6,7-dimethyl-1-(3-pentoxyphenyl)-2-(2-phenylethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4706800) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 6,7-dimethyl-1-(3-pentoxyphenyl)-2-(2-phenylethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 6,7-dimethyl-1-(3-pentoxyphenyl)-2-(2-phenylethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4706800 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 6,7-dimethyl-1-(3-pentoxyphenyl)-2-(2-phenylethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1cccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2CCc2ccccc2)c1 |
| InChI | InChI=1S/C32H33NO4/c1-4-5-9-17-36-25-14-10-13-24(20-25)29-28-30(34)26-18-21(2)22(3)19-27(26)37-31(28)32(35)33(29)16-15-23-11-7-6-8-12-23/h6-8,10-14,18-20,29H,4-5,9,15-17H2,1-3H3 |
| InChIKey | RPEMFMNRAZJGHD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|