C31H30ClNO5 — CID 18882864
7-chloro-6-methyl-1-(3-phenylmethoxyphenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18882864) has the molecular formula C31H30ClNO5 and a molecular weight of 532.04 g/mol. Its IUPAC name is 7-chloro-6-methyl-1-(3-phenylmethoxyphenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-6-methyl-1-(3-phenylmethoxyphenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18882864 |
| Molecular Formula | C31H30ClNO5 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 7-chloro-6-methyl-1-(3-phenylmethoxyphenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | Cc1cc2oc3c(c(=O)c2cc1Cl)C(c1cccc(OCc2ccccc2)c1)N(CCCOC(C)C)C3=O |
| InChI | InChI=1S/C31H30ClNO5/c1-19(2)36-14-8-13-33-28(22-11-7-12-23(16-22)37-18-21-9-5-4-6-10-21)27-29(34)24-17-25(32)20(3)15-26(24)38-30(27)31(33)35/h4-7,9-12,15-17,19,28H,8,13-14,18H2,1-3H3 |
| InChIKey | HZXWIFGNVMFUDD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|