C23H20ClNO3 — CID 18882412
7-chloro-1-(4-ethylphenyl)-6-methyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18882412) has the molecular formula C23H20ClNO3 and a molecular weight of 393.87 g/mol. Its IUPAC name is 7-chloro-1-(4-ethylphenyl)-6-methyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-1-(4-ethylphenyl)-6-methyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18882412 |
| Molecular Formula | C23H20ClNO3 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 7-chloro-1-(4-ethylphenyl)-6-methyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCN1C(=O)c2oc3cc(C)c(Cl)cc3c(=O)c2C1c1ccc(CC)cc1 |
| InChI | InChI=1S/C23H20ClNO3/c1-4-10-25-20(15-8-6-14(5-2)7-9-15)19-21(26)16-12-17(24)13(3)11-18(16)28-22(19)23(25)27/h4,6-9,11-12,20H,1,5,10H2,2-3H3 |
| InChIKey | XKUPVWVCCNLTEU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|