C22H18ClNO3 — CID 23471714
1-(4-chlorophenyl)-6,7-dimethyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 23471714) has the molecular formula C22H18ClNO3 and a molecular weight of 379.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6,7-dimethyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-chlorophenyl)-6,7-dimethyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 23471714 |
| Molecular Formula | C22H18ClNO3 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-(4-chlorophenyl)-6,7-dimethyl-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCN1C(=O)c2oc3cc(C)c(C)cc3c(=O)c2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClNO3/c1-4-9-24-19(14-5-7-15(23)8-6-14)18-20(25)16-10-12(2)13(3)11-17(16)27-21(18)22(24)26/h4-8,10-11,19H,1,9H2,2-3H3 |
| InChIKey | ZVMCORDHQBUZNU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|