C23H21NO3 — CID 23471707
6,7-dimethyl-1-(4-methylphenyl)-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 23471707) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 6,7-dimethyl-1-(4-methylphenyl)-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 6,7-dimethyl-1-(4-methylphenyl)-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 23471707 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 6,7-dimethyl-1-(4-methylphenyl)-2-prop-2-enyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCN1C(=O)c2oc3cc(C)c(C)cc3c(=O)c2C1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H21NO3/c1-5-10-24-20(16-8-6-13(2)7-9-16)19-21(25)17-11-14(3)15(4)12-18(17)27-22(19)23(24)26/h5-9,11-12,20H,1,10H2,2-4H3 |
| InChIKey | BPYNFHAIQIIKFT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|