C30H35BrN2O6 — CID 4709384
7-bromo-1-(3-ethoxy-4-pentoxyphenyl)-2-(2-morpholin-4-ylethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4709384) has the molecular formula C30H35BrN2O6 and a molecular weight of 599.52 g/mol. Its IUPAC name is 7-bromo-1-(3-ethoxy-4-pentoxyphenyl)-2-(2-morpholin-4-ylethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(3-ethoxy-4-pentoxyphenyl)-2-(2-morpholin-4-ylethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4709384 |
| Molecular Formula | C30H35BrN2O6 |
| Molecular Weight | 599.52 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 7-bromo-1-(3-ethoxy-4-pentoxyphenyl)-2-(2-morpholin-4-ylethyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2CCN2CCOCC2)cc1OCC |
| InChI | InChI=1S/C30H35BrN2O6/c1-3-5-6-15-38-24-9-7-20(18-25(24)37-4-2)27-26-28(34)22-19-21(31)8-10-23(22)39-29(26)30(35)33(27)12-11-32-13-16-36-17-14-32/h7-10,18-19,27H,3-6,11-17H2,1-2H3 |
| InChIKey | SRZKVKSQRCBUHJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|