C24H24BrNO5 — CID 18879748
7-bromo-1-(4-butoxy-3-ethoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18879748) has the molecular formula C24H24BrNO5 and a molecular weight of 486.36 g/mol. Its IUPAC name is 7-bromo-1-(4-butoxy-3-ethoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(4-butoxy-3-ethoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18879748 |
| Molecular Formula | C24H24BrNO5 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 7-bromo-1-(4-butoxy-3-ethoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2C)cc1OCC |
| InChI | InChI=1S/C24H24BrNO5/c1-4-6-11-30-18-9-7-14(12-19(18)29-5-2)21-20-22(27)16-13-15(25)8-10-17(16)31-23(20)24(28)26(21)3/h7-10,12-13,21H,4-6,11H2,1-3H3 |
| InChIKey | UTBUITHIIWALSJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|