C30H25BrF3NO5 — CID 18855133
7-bromo-1-(4-butoxy-3-ethoxyphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18855133) has the molecular formula C30H25BrF3NO5 and a molecular weight of 616.43 g/mol. Its IUPAC name is 7-bromo-1-(4-butoxy-3-ethoxyphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(4-butoxy-3-ethoxyphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18855133 |
| Molecular Formula | C30H25BrF3NO5 |
| Molecular Weight | 616.43 g/mol |
| Exact Mass | 615.09 |
| IUPAC Name | 7-bromo-1-(4-butoxy-3-ethoxyphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2c2cccc(C(F)(F)F)c2)cc1OCC |
| InChI | InChI=1S/C30H25BrF3NO5/c1-3-5-13-39-23-11-9-17(14-24(23)38-4-2)26-25-27(36)21-16-19(31)10-12-22(21)40-28(25)29(37)35(26)20-8-6-7-18(15-20)30(32,33)34/h6-12,14-16,26H,3-5,13H2,1-2H3 |
| InChIKey | HTZLCHOIEPDEKM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.43 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|