C29H23BrF3NO5 — CID 18854774
7-bromo-1-(4-butoxy-3-methoxyphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18854774) has the molecular formula C29H23BrF3NO5 and a molecular weight of 602.40 g/mol. Its IUPAC name is 7-bromo-1-(4-butoxy-3-methoxyphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(4-butoxy-3-methoxyphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18854774 |
| Molecular Formula | C29H23BrF3NO5 |
| Molecular Weight | 602.40 g/mol |
| Exact Mass | 601.07 |
| IUPAC Name | 7-bromo-1-(4-butoxy-3-methoxyphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2c2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C29H23BrF3NO5/c1-3-4-12-38-22-10-8-16(13-23(22)37-2)25-24-26(35)20-15-18(30)9-11-21(20)39-27(24)28(36)34(25)19-7-5-6-17(14-19)29(31,32)33/h5-11,13-15,25H,3-4,12H2,1-2H3 |
| InChIKey | LZHUXOMOGCFHIR-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.40 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|