C32H30ClNO7 — CID 18810212
2-(1,3-benzodioxol-5-ylmethyl)-7-chloro-1-(4-hexoxy-3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18810212) has the molecular formula C32H30ClNO7 and a molecular weight of 576.05 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-7-chloro-1-(4-hexoxy-3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-7-chloro-1-(4-hexoxy-3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18810212 |
| Molecular Formula | C32H30ClNO7 |
| Molecular Weight | 576.05 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-7-chloro-1-(4-hexoxy-3-methoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2Cc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C32H30ClNO7/c1-3-4-5-6-13-38-24-11-8-20(15-26(24)37-2)29-28-30(35)22-16-21(33)9-12-23(22)41-31(28)32(36)34(29)17-19-7-10-25-27(14-19)40-18-39-25/h7-12,14-16,29H,3-6,13,17-18H2,1-2H3 |
| InChIKey | RAEICCIBJPKYAC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 87.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.05 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|