C31H28BrNO7 — CID 18810498
2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-1-(3-methoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18810498) has the molecular formula C31H28BrNO7 and a molecular weight of 606.47 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-1-(3-methoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-1-(3-methoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18810498 |
| Molecular Formula | C31H28BrNO7 |
| Molecular Weight | 606.47 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-1-(3-methoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2Cc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C31H28BrNO7/c1-3-4-5-12-37-23-10-7-19(14-25(23)36-2)28-27-29(34)21-15-20(32)8-11-22(21)40-30(27)31(35)33(28)16-18-6-9-24-26(13-18)39-17-38-24/h6-11,13-15,28H,3-5,12,16-17H2,1-2H3 |
| InChIKey | MMEGZHWDNSYGES-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 87.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|