C28H33BrN2O5 — CID 4705388
7-bromo-1-(4-butoxy-3-methoxyphenyl)-2-[2-(diethylamino)ethyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4705388) has the molecular formula C28H33BrN2O5 and a molecular weight of 557.49 g/mol. Its IUPAC name is 7-bromo-1-(4-butoxy-3-methoxyphenyl)-2-[2-(diethylamino)ethyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(4-butoxy-3-methoxyphenyl)-2-[2-(diethylamino)ethyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4705388 |
| Molecular Formula | C28H33BrN2O5 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 7-bromo-1-(4-butoxy-3-methoxyphenyl)-2-[2-(diethylamino)ethyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2CCN(CC)CC)cc1OC |
| InChI | InChI=1S/C28H33BrN2O5/c1-5-8-15-35-22-11-9-18(16-23(22)34-4)25-24-26(32)20-17-19(29)10-12-21(20)36-27(24)28(33)31(25)14-13-30(6-2)7-3/h9-12,16-17,25H,5-8,13-15H2,1-4H3 |
| InChIKey | VHAVYWLVEKXDSL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|