C29H35BrN2O4 — CID 4705410
7-bromo-2-[2-(diethylamino)ethyl]-1-(4-hexoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4705410) has the molecular formula C29H35BrN2O4 and a molecular weight of 555.51 g/mol. Its IUPAC name is 7-bromo-2-[2-(diethylamino)ethyl]-1-(4-hexoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-2-[2-(diethylamino)ethyl]-1-(4-hexoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4705410 |
| Molecular Formula | C29H35BrN2O4 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 7-bromo-2-[2-(diethylamino)ethyl]-1-(4-hexoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2CCN(CC)CC)cc1 |
| InChI | InChI=1S/C29H35BrN2O4/c1-4-7-8-9-18-35-22-13-10-20(11-14-22)26-25-27(33)23-19-21(30)12-15-24(23)36-28(25)29(34)32(26)17-16-31(5-2)6-3/h10-15,19,26H,4-9,16-18H2,1-3H3 |
| InChIKey | XOFRVGZDWIGBGV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|