C29H25BrFNO4 — CID 18810589
7-bromo-2-[(4-fluorophenyl)methyl]-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18810589) has the molecular formula C29H25BrFNO4 and a molecular weight of 550.42 g/mol. Its IUPAC name is 7-bromo-2-[(4-fluorophenyl)methyl]-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-2-[(4-fluorophenyl)methyl]-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18810589 |
| Molecular Formula | C29H25BrFNO4 |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 7-bromo-2-[(4-fluorophenyl)methyl]-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H25BrFNO4/c1-2-3-4-15-35-22-12-7-19(8-13-22)26-25-27(33)23-16-20(30)9-14-24(23)36-28(25)29(34)32(26)17-18-5-10-21(31)11-6-18/h5-14,16,26H,2-4,15,17H2,1H3 |
| InChIKey | DXHLOIDYSYBQIS-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|