C31H30FNO4 — CID 19108758
2-[(4-fluorophenyl)methyl]-6,8-dimethyl-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19108758) has the molecular formula C31H30FNO4 and a molecular weight of 499.58 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-6,8-dimethyl-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-[(4-fluorophenyl)methyl]-6,8-dimethyl-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19108758 |
| Molecular Formula | C31H30FNO4 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-6,8-dimethyl-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4cc(C)cc(C)c4c3=O)C(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C31H30FNO4/c1-4-5-6-15-36-24-13-9-22(10-14-24)28-27-29(34)26-20(3)16-19(2)17-25(26)37-30(27)31(35)33(28)18-21-7-11-23(32)12-8-21/h7-14,16-17,28H,4-6,15,18H2,1-3H3 |
| InChIKey | LIFXGKZDXHTGNK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|