C31H33NO6 — CID 18880936
2-(furan-2-ylmethyl)-1-(4-hexoxy-3-methoxyphenyl)-5,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18880936) has the molecular formula C31H33NO6 and a molecular weight of 515.61 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-1-(4-hexoxy-3-methoxyphenyl)-5,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(furan-2-ylmethyl)-1-(4-hexoxy-3-methoxyphenyl)-5,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18880936 |
| Molecular Formula | C31H33NO6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-(furan-2-ylmethyl)-1-(4-hexoxy-3-methoxyphenyl)-5,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4c(C)cc(C)cc4c3=O)C(=O)N2Cc2ccco2)cc1OC |
| InChI | InChI=1S/C31H33NO6/c1-5-6-7-8-13-37-24-12-11-21(17-25(24)35-4)27-26-28(33)23-16-19(2)15-20(3)29(23)38-30(26)31(34)32(27)18-22-10-9-14-36-22/h9-12,14-17,27H,5-8,13,18H2,1-4H3 |
| InChIKey | ZLGDWTGQJDOIGV-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 82.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|