C30H37NO5 — CID 18880814
1-[3-methoxy-4-(3-methylbutoxy)phenyl]-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18880814) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is 1-[3-methoxy-4-(3-methylbutoxy)phenyl]-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-[3-methoxy-4-(3-methylbutoxy)phenyl]-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18880814 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 1-[3-methoxy-4-(3-methylbutoxy)phenyl]-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCN1C(=O)c2oc3c(C)cc(C)cc3c(=O)c2C1c1ccc(OCCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C30H37NO5/c1-7-8-9-13-31-26(21-10-11-23(24(17-21)34-6)35-14-12-18(2)3)25-27(32)22-16-19(4)15-20(5)28(22)36-29(25)30(31)33/h10-11,15-18,26H,7-9,12-14H2,1-6H3 |
| InChIKey | LKJURYUFGBVZAB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|