C32H33NO5 — CID 18880816
1-(3-methoxy-4-phenylmethoxyphenyl)-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18880816) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is 1-(3-methoxy-4-phenylmethoxyphenyl)-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-methoxy-4-phenylmethoxyphenyl)-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18880816 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1-(3-methoxy-4-phenylmethoxyphenyl)-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCN1C(=O)c2oc3c(C)cc(C)cc3c(=O)c2C1c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C32H33NO5/c1-5-6-10-15-33-28(23-13-14-25(26(18-23)36-4)37-19-22-11-8-7-9-12-22)27-29(34)24-17-20(2)16-21(3)30(24)38-31(27)32(33)35/h7-9,11-14,16-18,28H,5-6,10,15,19H2,1-4H3 |
| InChIKey | NRBZOYDZYTZKMQ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|