C24H23Cl2NO3 — CID 18880797
1-(3,4-dichlorophenyl)-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18880797) has the molecular formula C24H23Cl2NO3 and a molecular weight of 444.36 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18880797 |
| Molecular Formula | C24H23Cl2NO3 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-5,7-dimethyl-2-pentyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCN1C(=O)c2oc3c(C)cc(C)cc3c(=O)c2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H23Cl2NO3/c1-4-5-6-9-27-20(15-7-8-17(25)18(26)12-15)19-21(28)16-11-13(2)10-14(3)22(16)30-23(19)24(27)29/h7-8,10-12,20H,4-6,9H2,1-3H3 |
| InChIKey | OFYQCRKFJUJSOL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|