C29H30N2O8S — CID 18812165
methyl 2-[(3E)-3-[(4-butoxyphenyl)-hydroxymethylidene]-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 18812165) has the molecular formula C29H30N2O8S and a molecular weight of 566.63 g/mol. Its IUPAC name is methyl 2-[(3E)-3-[(4-butoxyphenyl)-hydroxymethylidene]-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(3E)-3-[(4-butoxyphenyl)-hydroxymethylidene]-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18812165 |
| Molecular Formula | C29H30N2O8S |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | methyl 2-[(3E)-3-[(4-butoxyphenyl)-hydroxymethylidene]-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc(C)c(C(=O)OC)s3)C2c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C29H30N2O8S/c1-6-7-14-39-18-10-8-17(9-11-18)24(32)22-23(20-15-19(36-3)12-13-21(20)37-4)31(27(34)25(22)33)29-30-16(2)26(40-29)28(35)38-5/h8-13,15,23,32H,6-7,14H2,1-5H3/b24-22+ |
| InChIKey | DJBZXMSCAUXTME-ZNTNEXAZSA-N |
| XLogP | 5.06 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|