C23H26FN3O2S — CID 18813051
N-(4-ethoxyphenyl)-4-(4-fluorophenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine (PubChem CID 18813051) has the molecular formula C23H26FN3O2S and a molecular weight of 427.55 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-(4-fluorophenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-ethoxyphenyl)-4-(4-fluorophenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18813051 |
| Molecular Formula | C23H26FN3O2S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-(4-fluorophenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
| SMILES | CCOc1ccc(/N=c2\scc(-c3ccc(F)cc3)n2CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H26FN3O2S/c1-2-29-21-9-7-20(8-10-21)25-23-27(12-11-26-13-15-28-16-14-26)22(17-30-23)18-3-5-19(24)6-4-18/h3-10,17H,2,11-16H2,1H3/b25-23- |
| InChIKey | BDAPSHNBVBXMJO-BZZOAKBMSA-N |
| XLogP | 4.32 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|