C28H21BrClN3O4S2 — CID 18814953
(4Z)-5-(3-bromophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(4-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 18814953) has the molecular formula C28H21BrClN3O4S2 and a molecular weight of 642.98 g/mol. Its IUPAC name is (4Z)-5-(3-bromophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(4-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3-bromophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(4-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18814953 |
| Molecular Formula | C28H21BrClN3O4S2 |
| Molecular Weight | 642.98 g/mol |
| Exact Mass | 640.98 |
| IUPAC Name | (4Z)-5-(3-bromophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(4-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3nnc(SCc4ccc(Cl)cc4)s3)C2c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C28H21BrClN3O4S2/c1-2-37-21-12-8-17(9-13-21)24(34)22-23(18-4-3-5-19(29)14-18)33(26(36)25(22)35)27-31-32-28(39-27)38-15-16-6-10-20(30)11-7-16/h3-14,23,34H,2,15H2,1H3/b24-22- |
| InChIKey | VXVFFYGOGQNLPK-GYHWCHFESA-N |
| XLogP | 7.27 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.98 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|