C30H25Cl2N3O4S2 — CID 3560461
4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-chlorophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione (PubChem CID 3560461) has the molecular formula C30H25Cl2N3O4S2 and a molecular weight of 626.59 g/mol. Its IUPAC name is 4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-chlorophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-chlorophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3560461 |
| Molecular Formula | C30H25Cl2N3O4S2 |
| Molecular Weight | 626.59 g/mol |
| Exact Mass | 625.07 |
| IUPAC Name | 4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-chlorophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(C(O)=C2C(=O)C(=O)N(c3nnc(SCc4ccc(Cl)cc4)s3)C2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C30H25Cl2N3O4S2/c1-2-3-15-39-23-13-9-19(10-14-23)26(36)24-25(20-5-4-6-22(32)16-20)35(28(38)27(24)37)29-33-34-30(41-29)40-17-18-7-11-21(31)12-8-18/h4-14,16,25,36H,2-3,15,17H2,1H3 |
| InChIKey | BCLUJTWHXWTCEL-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.59 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|