C30H26N4O6S2 — CID 4600381
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 4600381) has the molecular formula C30H26N4O6S2 and a molecular weight of 602.69 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4600381 |
| Molecular Formula | C30H26N4O6S2 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(C(O)=C2C(=O)C(=O)N(c3nnc(SCc4ccccc4)s3)C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C30H26N4O6S2/c1-2-3-16-40-23-14-12-20(13-15-23)26(35)24-25(21-10-7-11-22(17-21)34(38)39)33(28(37)27(24)36)29-31-32-30(42-29)41-18-19-8-5-4-6-9-19/h4-15,17,25,35H,2-3,16,18H2,1H3 |
| InChIKey | YOGDLDQVQIGBBR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|