C32H30ClN3O6S2 — CID 6078752
(4E)-4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4-dimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6078752) has the molecular formula C32H30ClN3O6S2 and a molecular weight of 652.19 g/mol. Its IUPAC name is (4E)-4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4-dimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4-dimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6078752 |
| Molecular Formula | C32H30ClN3O6S2 |
| Molecular Weight | 652.19 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | (4E)-4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4-dimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nnc(SCc4ccc(Cl)cc4)s3)C2c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H30ClN3O6S2/c1-4-5-16-42-23-13-8-20(9-14-23)28(37)26-27(21-10-15-24(40-2)25(17-21)41-3)36(30(39)29(26)38)31-34-35-32(44-31)43-18-19-6-11-22(33)12-7-19/h6-15,17,27,37H,4-5,16,18H2,1-3H3/b28-26+ |
| InChIKey | VMQDSAUIUJSNIX-BYCLXTJYSA-N |
| XLogP | 7.31 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.19 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|