C38H42FN3O6S2 — CID 3528544
4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-heptoxy-3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 3528544) has the molecular formula C38H42FN3O6S2 and a molecular weight of 719.90 g/mol. Its IUPAC name is 4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-heptoxy-3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-heptoxy-3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3528544 |
| Molecular Formula | C38H42FN3O6S2 |
| Molecular Weight | 719.90 g/mol |
| Exact Mass | 719.25 |
| IUPAC Name | 4-[(4-butoxyphenyl)-hydroxymethylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-heptoxy-3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCCCOc1ccc(C2C(=C(O)c3ccc(OCCCC)cc3)C(=O)C(=O)N2c2nnc(SCc3ccc(F)cc3)s2)cc1OC |
| InChI | InChI=1S/C38H42FN3O6S2/c1-4-6-8-9-10-22-48-30-20-15-27(23-31(30)46-3)33-32(34(43)26-13-18-29(19-14-26)47-21-7-5-2)35(44)36(45)42(33)37-40-41-38(50-37)49-24-25-11-16-28(39)17-12-25/h11-20,23,33,43H,4-10,21-22,24H2,1-3H3 |
| InChIKey | ONCLLHUWFGXEIQ-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.90 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|