C31H27Cl2N3O6S2 — CID 18816344
(4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 18816344) has the molecular formula C31H27Cl2N3O6S2 and a molecular weight of 672.61 g/mol. Its IUPAC name is (4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18816344 |
| Molecular Formula | C31H27Cl2N3O6S2 |
| Molecular Weight | 672.61 g/mol |
| Exact Mass | 671.07 |
| IUPAC Name | (4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3nnc(SCc4ccc(Cl)cc4Cl)s3)C2c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C31H27Cl2N3O6S2/c1-4-13-42-21-10-6-17(7-11-21)27(37)25-26(18-8-12-23(40-2)24(14-18)41-3)36(29(39)28(25)38)30-34-35-31(44-30)43-16-19-5-9-20(32)15-22(19)33/h5-12,14-15,26,37H,4,13,16H2,1-3H3/b27-25- |
| InChIKey | MZTWTIATYSWDIO-RFBIWTDZSA-N |
| XLogP | 7.57 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.61 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|