C32H28Cl2FN3O5S2 — CID 18816165
(4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 18816165) has the molecular formula C32H28Cl2FN3O5S2 and a molecular weight of 688.63 g/mol. Its IUPAC name is (4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18816165 |
| Molecular Formula | C32H28Cl2FN3O5S2 |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 687.08 |
| IUPAC Name | (4Z)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2/C(=C(/O)c3ccc(F)cc3)C(=O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3Cl)s2)cc1OC |
| InChI | InChI=1S/C32H28Cl2FN3O5S2/c1-3-4-5-14-43-24-13-9-19(15-25(24)42-2)27-26(28(39)18-7-11-22(35)12-8-18)29(40)30(41)38(27)31-36-37-32(45-31)44-17-20-6-10-21(33)16-23(20)34/h6-13,15-16,27,39H,3-5,14,17H2,1-2H3/b28-26- |
| InChIKey | ODCFZRDDKFVUFY-SGEDCAFJSA-N |
| XLogP | 8.48 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|